C17H9Cl2N3O2S — CID 4969889
2-(2,4-dichlorophenyl)-5-(furan-2-ylmethylidene)-3-(1,3-thiazol-2-yl)imidazol-4-one (PubChem CID 4969889) has the molecular formula C17H9Cl2N3O2S and a molecular weight of 390.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-(furan-2-ylmethylidene)-3-(1,3-thiazol-2-yl)imidazol-4-one.
| Compound Name | 2-(2,4-dichlorophenyl)-5-(furan-2-ylmethylidene)-3-(1,3-thiazol-2-yl)imidazol-4-one |
|---|---|
| PubChem CID | 4969889 |
| Molecular Formula | C17H9Cl2N3O2S |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-(furan-2-ylmethylidene)-3-(1,3-thiazol-2-yl)imidazol-4-one |
| SMILES | O=C1C(=Cc2ccco2)N=C(c2ccc(Cl)cc2Cl)N1c1nccs1 |
| InChI | InChI=1S/C17H9Cl2N3O2S/c18-10-3-4-12(13(19)8-10)15-21-14(9-11-2-1-6-24-11)16(23)22(15)17-20-5-7-25-17/h1-9H |
| InChIKey | UVIQFLZCQBCOQV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|