C23H15Cl3N2O2 — CID 126003167
(5E)-2-(2-chlorophenyl)-5-[(2,4-dichlorophenyl)methylidene]-3-(4-methoxyphenyl)imidazol-4-one (PubChem CID 126003167) has the molecular formula C23H15Cl3N2O2 and a molecular weight of 457.74 g/mol. Its IUPAC name is (5E)-2-(2-chlorophenyl)-5-[(2,4-dichlorophenyl)methylidene]-3-(4-methoxyphenyl)imidazol-4-one.
| Compound Name | (5E)-2-(2-chlorophenyl)-5-[(2,4-dichlorophenyl)methylidene]-3-(4-methoxyphenyl)imidazol-4-one |
|---|---|
| PubChem CID | 126003167 |
| Molecular Formula | C23H15Cl3N2O2 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | (5E)-2-(2-chlorophenyl)-5-[(2,4-dichlorophenyl)methylidene]-3-(4-methoxyphenyl)imidazol-4-one |
| SMILES | COc1ccc(N2C(=O)/C(=C\c3ccc(Cl)cc3Cl)N=C2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H15Cl3N2O2/c1-30-17-10-8-16(9-11-17)28-22(18-4-2-3-5-19(18)25)27-21(23(28)29)12-14-6-7-15(24)13-20(14)26/h2-13H,1H3/b21-12+ |
| InChIKey | PYNWRYQZEVUNGG-CIAFOILYSA-N |
| XLogP | 6.49 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|