C18H11Cl2NO4S — CID 126843699
(5E)-5-[(2,4-dichlorophenyl)methylidene]-3-(4-methoxybenzoyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126843699) has the molecular formula C18H11Cl2NO4S and a molecular weight of 408.26 g/mol. Its IUPAC name is (5E)-5-[(2,4-dichlorophenyl)methylidene]-3-(4-methoxybenzoyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2,4-dichlorophenyl)methylidene]-3-(4-methoxybenzoyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126843699 |
| Molecular Formula | C18H11Cl2NO4S |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | (5E)-5-[(2,4-dichlorophenyl)methylidene]-3-(4-methoxybenzoyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(C(=O)N2C(=O)S/C(=C/c3ccc(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C18H11Cl2NO4S/c1-25-13-6-3-10(4-7-13)16(22)21-17(23)15(26-18(21)24)8-11-2-5-12(19)9-14(11)20/h2-9H,1H3/b15-8+ |
| InChIKey | STZWLAUPQSHWAI-OVCLIPMQSA-N |
| XLogP | 4.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|