C18H13NO4S — CID 171132370
3-benzoyl-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 171132370) has the molecular formula C18H13NO4S and a molecular weight of 339.37 g/mol. Its IUPAC name is 3-benzoyl-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-benzoyl-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 171132370 |
| Molecular Formula | C18H13NO4S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 3-benzoyl-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(C=C2SC(=O)N(C(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C18H13NO4S/c1-23-14-9-7-12(8-10-14)11-15-17(21)19(18(22)24-15)16(20)13-5-3-2-4-6-13/h2-11H,1H3 |
| InChIKey | OTVQUJSIDCSLKX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|