C26H20N2O6S — CID 172511059
4-[[3-benzoyl-5-[(3,5-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 172511059) has the molecular formula C26H20N2O6S and a molecular weight of 488.52 g/mol. Its IUPAC name is 4-[[3-benzoyl-5-[(3,5-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[3-benzoyl-5-[(3,5-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 172511059 |
| Molecular Formula | C26H20N2O6S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 4-[[3-benzoyl-5-[(3,5-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | COc1cc(C=C2S/C(=N\c3ccc(C(=O)O)cc3)N(C(=O)c3ccccc3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C26H20N2O6S/c1-33-20-12-16(13-21(15-20)34-2)14-22-24(30)28(23(29)17-6-4-3-5-7-17)26(35-22)27-19-10-8-18(9-11-19)25(31)32/h3-15H,1-2H3,(H,31,32)/b22-14?,27-26- |
| InChIKey | SSCHCRGPHSXXCT-FTLOEKDTSA-N |
| XLogP | 4.85 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|