C30H25N3O4S — CID 50857955
4-[[(5E)-5-[[1-(4-methoxyphenyl)-5-methylpyrrol-3-yl]methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]methyl]benzoic acid (PubChem CID 50857955) has the molecular formula C30H25N3O4S and a molecular weight of 523.61 g/mol. Its IUPAC name is 4-[[(5E)-5-[[1-(4-methoxyphenyl)-5-methylpyrrol-3-yl]methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[(5E)-5-[[1-(4-methoxyphenyl)-5-methylpyrrol-3-yl]methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 50857955 |
| Molecular Formula | C30H25N3O4S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 4-[[(5E)-5-[[1-(4-methoxyphenyl)-5-methylpyrrol-3-yl]methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]methyl]benzoic acid |
| SMILES | COc1ccc(-n2cc(/C=C3/S/C(=N\c4ccccc4)N(Cc4ccc(C(=O)O)cc4)C3=O)cc2C)cc1 |
| InChI | InChI=1S/C30H25N3O4S/c1-20-16-22(19-32(20)25-12-14-26(37-2)15-13-25)17-27-28(34)33(18-21-8-10-23(11-9-21)29(35)36)30(38-27)31-24-6-4-3-5-7-24/h3-17,19H,18H2,1-2H3,(H,35,36)/b27-17+,31-30- |
| InChIKey | YRZRNAJGRUUTSI-IKFAVLQYSA-N |
| XLogP | 6.30 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|