C34H31N3O4S — CID 126383321
N-(3,4-dimethylphenyl)-2-[3-[(Z)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126383321) has the molecular formula C34H31N3O4S and a molecular weight of 577.71 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[3-[(Z)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[3-[(Z)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126383321 |
| Molecular Formula | C34H31N3O4S |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[3-[(Z)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1ccc(CN2C(=O)/C(=C/c3cccc(OCC(=O)Nc4ccc(C)c(C)c4)c3)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C34H31N3O4S/c1-23-12-15-28(18-24(23)2)35-32(38)22-41-30-11-7-8-26(19-30)20-31-33(39)37(21-25-13-16-29(40-3)17-14-25)34(42-31)36-27-9-5-4-6-10-27/h4-20H,21-22H2,1-3H3,(H,35,38)/b31-20-,36-34- |
| InChIKey | QZOMPRIASNMHNC-YABUFAANSA-N |
| XLogP | 7.13 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|