C27H24N2O4S — CID 5218107
methyl 4-[[3-[(3-ethyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoate (PubChem CID 5218107) has the molecular formula C27H24N2O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is methyl 4-[[3-[(3-ethyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[3-[(3-ethyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 5218107 |
| Molecular Formula | C27H24N2O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | methyl 4-[[3-[(3-ethyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoate |
| SMILES | CCN1C(=O)C(=Cc2cccc(OCc3ccc(C(=O)OC)cc3)c2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C27H24N2O4S/c1-3-29-25(30)24(34-27(29)28-22-9-5-4-6-10-22)17-20-8-7-11-23(16-20)33-18-19-12-14-21(15-13-19)26(31)32-2/h4-17H,3,18H2,1-2H3/b24-17?,28-27- |
| InChIKey | VJOBAZRPPXQFPN-VFFGVJMWSA-N |
| XLogP | 5.68 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|