C24H17NO5S — CID 126355466
[4-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate (PubChem CID 126355466) has the molecular formula C24H17NO5S and a molecular weight of 431.47 g/mol. Its IUPAC name is [4-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126355466 |
| Molecular Formula | C24H17NO5S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | [4-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=C3\SC(=O)N(c4ccccc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C24H17NO5S/c1-29-19-13-9-17(10-14-19)23(27)30-20-11-7-16(8-12-20)15-21-22(26)25(24(28)31-21)18-5-3-2-4-6-18/h2-15H,1H3/b21-15- |
| InChIKey | RCVGEAGLEOCWQB-QNGOZBTKSA-N |
| XLogP | 5.16 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|