C25H22N2O4 — CID 6103653
(5E)-5-[(2,4-dimethoxyphenyl)methylidene]-3-(2-methoxyphenyl)-2-phenylimidazol-4-one (PubChem CID 6103653) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is (5E)-5-[(2,4-dimethoxyphenyl)methylidene]-3-(2-methoxyphenyl)-2-phenylimidazol-4-one.
| Compound Name | (5E)-5-[(2,4-dimethoxyphenyl)methylidene]-3-(2-methoxyphenyl)-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 6103653 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (5E)-5-[(2,4-dimethoxyphenyl)methylidene]-3-(2-methoxyphenyl)-2-phenylimidazol-4-one |
| SMILES | COc1ccc(/C=C2/N=C(c3ccccc3)N(c3ccccc3OC)C2=O)c(OC)c1 |
| InChI | InChI=1S/C25H22N2O4/c1-29-19-14-13-18(23(16-19)31-3)15-20-25(28)27(21-11-7-8-12-22(21)30-2)24(26-20)17-9-5-4-6-10-17/h4-16H,1-3H3/b20-15+ |
| InChIKey | QTBKBSYYOZXCLM-HMMYKYKNSA-N |
| XLogP | 4.55 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|