C26H21N3O4S — CID 1273988
(5E)-3-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-5-[(2-methoxyphenyl)methylidene]-2-phenylimidazol-4-one (PubChem CID 1273988) has the molecular formula C26H21N3O4S and a molecular weight of 471.54 g/mol. Its IUPAC name is (5E)-3-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-5-[(2-methoxyphenyl)methylidene]-2-phenylimidazol-4-one.
| Compound Name | (5E)-3-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-5-[(2-methoxyphenyl)methylidene]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 1273988 |
| Molecular Formula | C26H21N3O4S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (5E)-3-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-5-[(2-methoxyphenyl)methylidene]-2-phenylimidazol-4-one |
| SMILES | COc1ccccc1/C=C1/N=C(c2ccccc2)N(c2nc3c(OC)ccc(OC)c3s2)C1=O |
| InChI | InChI=1S/C26H21N3O4S/c1-31-19-12-8-7-11-17(19)15-18-25(30)29(24(27-18)16-9-5-4-6-10-16)26-28-22-20(32-2)13-14-21(33-3)23(22)34-26/h4-15H,1-3H3/b18-15+ |
| InChIKey | QPNDLUWEIWVMLP-OBGWFSINSA-N |
| XLogP | 5.16 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|