C26H20N4O3 — CID 135434090
6-[(4E)-4-[(2-methoxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-2-methyl-3H-quinazolin-4-one (PubChem CID 135434090) has the molecular formula C26H20N4O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is 6-[(4E)-4-[(2-methoxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-2-methyl-3H-quinazolin-4-one.
| Compound Name | 6-[(4E)-4-[(2-methoxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-2-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135434090 |
| Molecular Formula | C26H20N4O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 6-[(4E)-4-[(2-methoxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-2-methyl-3H-quinazolin-4-one |
| SMILES | COc1ccccc1/C=C1/N=C(c2ccccc2)N(c2ccc3nc(C)[nH]c(=O)c3c2)C1=O |
| InChI | InChI=1S/C26H20N4O3/c1-16-27-21-13-12-19(15-20(21)25(31)28-16)30-24(17-8-4-3-5-9-17)29-22(26(30)32)14-18-10-6-7-11-23(18)33-2/h3-15H,1-2H3,(H,27,28,31)/b22-14+ |
| InChIKey | CCDWWJQRAFOSKR-HYARGMPZSA-N |
| XLogP | 4.07 |
| TPSA | 87.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|