C24H15ClFN3O2S — CID 3869257
3-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-5-[(4-methoxyphenyl)methylidene]-2-phenylimidazol-4-one (PubChem CID 3869257) has the molecular formula C24H15ClFN3O2S and a molecular weight of 463.92 g/mol. Its IUPAC name is 3-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-5-[(4-methoxyphenyl)methylidene]-2-phenylimidazol-4-one.
| Compound Name | 3-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-5-[(4-methoxyphenyl)methylidene]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 3869257 |
| Molecular Formula | C24H15ClFN3O2S |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 3-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-5-[(4-methoxyphenyl)methylidene]-2-phenylimidazol-4-one |
| SMILES | COc1ccc(C=C2N=C(c3ccccc3)N(c3nc4cc(Cl)c(F)cc4s3)C2=O)cc1 |
| InChI | InChI=1S/C24H15ClFN3O2S/c1-31-16-9-7-14(8-10-16)11-20-23(30)29(22(27-20)15-5-3-2-4-6-15)24-28-19-12-17(25)18(26)13-21(19)32-24/h2-13H,1H3 |
| InChIKey | DSHGEADALXROER-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|