C23H14ClN3OS — CID 3777613
5-benzylidene-3-(5-chloro-1,3-benzothiazol-2-yl)-2-phenylimidazol-4-one (PubChem CID 3777613) has the molecular formula C23H14ClN3OS and a molecular weight of 415.91 g/mol. Its IUPAC name is 5-benzylidene-3-(5-chloro-1,3-benzothiazol-2-yl)-2-phenylimidazol-4-one.
| Compound Name | 5-benzylidene-3-(5-chloro-1,3-benzothiazol-2-yl)-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 3777613 |
| Molecular Formula | C23H14ClN3OS |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 5-benzylidene-3-(5-chloro-1,3-benzothiazol-2-yl)-2-phenylimidazol-4-one |
| SMILES | O=C1C(=Cc2ccccc2)N=C(c2ccccc2)N1c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C23H14ClN3OS/c24-17-11-12-20-18(14-17)26-23(29-20)27-21(16-9-5-2-6-10-16)25-19(22(27)28)13-15-7-3-1-4-8-15/h1-14H |
| InChIKey | TTYXTXIWLVPUHB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|