C23H16ClN3O — CID 20845059
(5E)-5-benzylidene-3-[(E)-(4-chlorophenyl)methylideneamino]-2-phenylimidazol-4-one (PubChem CID 20845059) has the molecular formula C23H16ClN3O and a molecular weight of 385.85 g/mol. Its IUPAC name is (5E)-5-benzylidene-3-[(E)-(4-chlorophenyl)methylideneamino]-2-phenylimidazol-4-one.
| Compound Name | (5E)-5-benzylidene-3-[(E)-(4-chlorophenyl)methylideneamino]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 20845059 |
| Molecular Formula | C23H16ClN3O |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (5E)-5-benzylidene-3-[(E)-(4-chlorophenyl)methylideneamino]-2-phenylimidazol-4-one |
| SMILES | O=C1/C(=C\c2ccccc2)N=C(c2ccccc2)N1/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H16ClN3O/c24-20-13-11-18(12-14-20)16-25-27-22(19-9-5-2-6-10-19)26-21(23(27)28)15-17-7-3-1-4-8-17/h1-16H/b21-15+,25-16+ |
| InChIKey | LVGIQYSBHSSBAM-UPXQHGRYSA-N |
| XLogP | 5.00 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|