C24H18ClN3O3 — CID 10622588
2-(4-chlorophenyl)-N-[(4Z)-4-[(4-hydroxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]acetamide (PubChem CID 10622588) has the molecular formula C24H18ClN3O3 and a molecular weight of 431.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(4Z)-4-[(4-hydroxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(4Z)-4-[(4-hydroxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 10622588 |
| Molecular Formula | C24H18ClN3O3 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(4Z)-4-[(4-hydroxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NN1C(=O)/C(=C/c2ccc(O)cc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C24H18ClN3O3/c25-19-10-6-17(7-11-19)15-22(30)27-28-23(18-4-2-1-3-5-18)26-21(24(28)31)14-16-8-12-20(29)13-9-16/h1-14,29H,15H2,(H,27,30)/b21-14- |
| InChIKey | KQHNCGGSHWDIIL-STZFKDTASA-N |
| XLogP | 3.95 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|