C24H18ClN3O4S — CID 3895481
N-[4-[4-[(4-chlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]sulfonylphenyl]acetamide (PubChem CID 3895481) has the molecular formula C24H18ClN3O4S and a molecular weight of 479.95 g/mol. Its IUPAC name is N-[4-[4-[(4-chlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[4-[(4-chlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 3895481 |
| Molecular Formula | C24H18ClN3O4S |
| Molecular Weight | 479.95 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | N-[4-[4-[(4-chlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2C(=O)C(=Cc3ccc(Cl)cc3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18ClN3O4S/c1-16(29)26-20-11-13-21(14-12-20)33(31,32)28-23(18-5-3-2-4-6-18)27-22(24(28)30)15-17-7-9-19(25)10-8-17/h2-15H,1H3,(H,26,29) |
| InChIKey | MLJHYSTXYQJPDS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.95 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|