C28H28N4O2 — CID 3701856
N-[4-[4-[[4-(diethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]phenyl]acetamide (PubChem CID 3701856) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[4-[4-[[4-(diethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-[[4-(diethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3701856 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | N-[4-[4-[[4-(diethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(C=C2N=C(c3ccccc3)N(c3ccc(NC(C)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H28N4O2/c1-4-31(5-2)24-15-11-21(12-16-24)19-26-28(34)32(27(30-26)22-9-7-6-8-10-22)25-17-13-23(14-18-25)29-20(3)33/h6-19H,4-5H2,1-3H3,(H,29,33) |
| InChIKey | RNBURNYTHDRJGM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|