C28H25N3O2 — CID 12791986
(5Z)-5-benzylidene-2-phenyl-3-[4-(piperidine-1-carbonyl)phenyl]imidazol-4-one (PubChem CID 12791986) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is (5Z)-5-benzylidene-2-phenyl-3-[4-(piperidine-1-carbonyl)phenyl]imidazol-4-one.
| Compound Name | (5Z)-5-benzylidene-2-phenyl-3-[4-(piperidine-1-carbonyl)phenyl]imidazol-4-one |
|---|---|
| PubChem CID | 12791986 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (5Z)-5-benzylidene-2-phenyl-3-[4-(piperidine-1-carbonyl)phenyl]imidazol-4-one |
| SMILES | O=C(c1ccc(N2C(=O)/C(=C/c3ccccc3)N=C2c2ccccc2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C28H25N3O2/c32-27(30-18-8-3-9-19-30)23-14-16-24(17-15-23)31-26(22-12-6-2-7-13-22)29-25(28(31)33)20-21-10-4-1-5-11-21/h1-2,4-7,10-17,20H,3,8-9,18-19H2/b25-20- |
| InChIKey | UMPUYOBHOYAJMC-QQTULTPQSA-N |
| XLogP | 5.15 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|