C22H16N2O2 — CID 102169883
(5Z)-5-[(4-hydroxyphenyl)methylidene]-2,3-diphenylimidazol-4-one (PubChem CID 102169883) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is (5Z)-5-[(4-hydroxyphenyl)methylidene]-2,3-diphenylimidazol-4-one.
| Compound Name | (5Z)-5-[(4-hydroxyphenyl)methylidene]-2,3-diphenylimidazol-4-one |
|---|---|
| PubChem CID | 102169883 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (5Z)-5-[(4-hydroxyphenyl)methylidene]-2,3-diphenylimidazol-4-one |
| SMILES | O=C1/C(=C/c2ccc(O)cc2)N=C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H16N2O2/c25-19-13-11-16(12-14-19)15-20-22(26)24(18-9-5-2-6-10-18)21(23-20)17-7-3-1-4-8-17/h1-15,25H/b20-15- |
| InChIKey | UAGQOCPSANNCLW-HKWRFOASSA-N |
| XLogP | 4.23 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|