C44H29N5O4S — CID 3381044
5-[(4-hydroxyphenyl)methylidene]-3-[7-[4-[(4-hydroxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-10H-phenothiazin-3-yl]-2-phenylimidazol-4-one (PubChem CID 3381044) has the molecular formula C44H29N5O4S and a molecular weight of 723.81 g/mol. Its IUPAC name is 5-[(4-hydroxyphenyl)methylidene]-3-[7-[4-[(4-hydroxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-10H-phenothiazin-3-yl]-2-phenylimidazol-4-one.
| Compound Name | 5-[(4-hydroxyphenyl)methylidene]-3-[7-[4-[(4-hydroxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-10H-phenothiazin-3-yl]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 3381044 |
| Molecular Formula | C44H29N5O4S |
| Molecular Weight | 723.81 g/mol |
| Exact Mass | 723.19 |
| IUPAC Name | 5-[(4-hydroxyphenyl)methylidene]-3-[7-[4-[(4-hydroxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-10H-phenothiazin-3-yl]-2-phenylimidazol-4-one |
| SMILES | O=C1C(=Cc2ccc(O)cc2)N=C(c2ccccc2)N1c1ccc2c(c1)Sc1cc(N3C(=O)C(=Cc4ccc(O)cc4)N=C3c3ccccc3)ccc1N2 |
| InChI | InChI=1S/C44H29N5O4S/c50-33-17-11-27(12-18-33)23-37-43(52)48(41(46-37)29-7-3-1-4-8-29)31-15-21-35-39(25-31)54-40-26-32(16-22-36(40)45-35)49-42(30-9-5-2-6-10-30)47-38(44(49)53)24-28-13-19-34(51)20-14-28/h1-26,45,50-51H |
| InChIKey | BEPBHEWTGXITLA-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.81 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|