C30H22ClN3O2 — CID 3842568
4-[4-[(4-chlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-N-(4-methylphenyl)benzamide (PubChem CID 3842568) has the molecular formula C30H22ClN3O2 and a molecular weight of 491.98 g/mol. Its IUPAC name is 4-[4-[(4-chlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-N-(4-methylphenyl)benzamide.
| Compound Name | 4-[4-[(4-chlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-N-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 3842568 |
| Molecular Formula | C30H22ClN3O2 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 4-[4-[(4-chlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-N-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(N3C(=O)C(=Cc4ccc(Cl)cc4)N=C3c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H22ClN3O2/c1-20-7-15-25(16-8-20)32-29(35)23-11-17-26(18-12-23)34-28(22-5-3-2-4-6-22)33-27(30(34)36)19-21-9-13-24(31)14-10-21/h2-19H,1H3,(H,32,35) |
| InChIKey | XKOPXZVGMARSKT-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|