C27H24N4O3S — CID 21232643
4-[2-[(4E)-4-[(4-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropanoylamino]benzamide (PubChem CID 21232643) has the molecular formula C27H24N4O3S and a molecular weight of 484.58 g/mol. Its IUPAC name is 4-[2-[(4E)-4-[(4-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropanoylamino]benzamide.
| Compound Name | 4-[2-[(4E)-4-[(4-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropanoylamino]benzamide |
|---|---|
| PubChem CID | 21232643 |
| Molecular Formula | C27H24N4O3S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 4-[2-[(4E)-4-[(4-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropanoylamino]benzamide |
| SMILES | Cc1ccc(/C=C2/N=C(SC(C)C(=O)Nc3ccc(C(N)=O)cc3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H24N4O3S/c1-17-8-10-19(11-9-17)16-23-26(34)31(22-6-4-3-5-7-22)27(30-23)35-18(2)25(33)29-21-14-12-20(13-15-21)24(28)32/h3-16,18H,1-2H3,(H2,28,32)(H,29,33)/b23-16+ |
| InChIKey | OWDVGGCRPVMHPT-XQNSMLJCSA-N |
| XLogP | 4.60 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|