C37H31N5O4S — CID 21172350
2-[4-[2-[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropanoylamino]phenyl]quinoline-4-carboxylic acid (PubChem CID 21172350) has the molecular formula C37H31N5O4S and a molecular weight of 641.75 g/mol. Its IUPAC name is 2-[4-[2-[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropanoylamino]phenyl]quinoline-4-carboxylic acid.
| Compound Name | 2-[4-[2-[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropanoylamino]phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 21172350 |
| Molecular Formula | C37H31N5O4S |
| Molecular Weight | 641.75 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | 2-[4-[2-[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropanoylamino]phenyl]quinoline-4-carboxylic acid |
| SMILES | CC(SC1=N/C(=C\c2ccc(N(C)C)cc2)C(=O)N1c1ccccc1)C(=O)Nc1ccc(-c2cc(C(=O)O)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C37H31N5O4S/c1-23(34(43)38-26-17-15-25(16-18-26)32-22-30(36(45)46)29-11-7-8-12-31(29)39-32)47-37-40-33(21-24-13-19-27(20-14-24)41(2)3)35(44)42(37)28-9-5-4-6-10-28/h4-23H,1-3H3,(H,38,43)(H,45,46)/b33-21- |
| InChIKey | QKFTYVLLOZDPHG-HWIUFGAZSA-N |
| XLogP | 7.17 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.75 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|