C29H28N4O4S — CID 21232623
methyl 2-[2-[(4E)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropanoylamino]benzoate (PubChem CID 21232623) has the molecular formula C29H28N4O4S and a molecular weight of 528.63 g/mol. Its IUPAC name is methyl 2-[2-[(4E)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropanoylamino]benzoate.
| Compound Name | methyl 2-[2-[(4E)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 21232623 |
| Molecular Formula | C29H28N4O4S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | methyl 2-[2-[(4E)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropanoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)SC1=N/C(=C/c2ccc(N(C)C)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C29H28N4O4S/c1-19(26(34)30-24-13-9-8-12-23(24)28(36)37-4)38-29-31-25(18-20-14-16-21(17-15-20)32(2)3)27(35)33(29)22-10-6-5-7-11-22/h5-19H,1-4H3,(H,30,34)/b25-18+ |
| InChIKey | MIOOWBHQHUHVND-XIEYBQDHSA-N |
| XLogP | 5.04 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|