C22H22N4O5S — CID 3493754
N-carbamoyl-2-[1-(3-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylpropanamide (PubChem CID 3493754) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is N-carbamoyl-2-[1-(3-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylpropanamide.
| Compound Name | N-carbamoyl-2-[1-(3-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 3493754 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-carbamoyl-2-[1-(3-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylpropanamide |
| SMILES | COc1ccc(C=C2N=C(SC(C)C(=O)NC(N)=O)N(c3cccc(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H22N4O5S/c1-13(19(27)25-21(23)29)32-22-24-18(11-14-7-9-16(30-2)10-8-14)20(28)26(22)15-5-4-6-17(12-15)31-3/h4-13H,1-3H3,(H3,23,25,27,29) |
| InChIKey | GHAYYYMGBSRBNQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|