C22H23N3O3S — CID 7440083
(2S)-2-[(4Z)-1-(3,5-dimethylphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylpropanamide (PubChem CID 7440083) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is (2S)-2-[(4Z)-1-(3,5-dimethylphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylpropanamide.
| Compound Name | (2S)-2-[(4Z)-1-(3,5-dimethylphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7440083 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (2S)-2-[(4Z)-1-(3,5-dimethylphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylpropanamide |
| SMILES | COc1ccc(/C=C2\N=C(S[C@@H](C)C(N)=O)N(c3cc(C)cc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-13-9-14(2)11-17(10-13)25-21(27)19(24-22(25)29-15(3)20(23)26)12-16-5-7-18(28-4)8-6-16/h5-12,15H,1-4H3,(H2,23,26)/b19-12-/t15-/m0/s1 |
| InChIKey | OHNQWZPFCDWHCW-CCRNYGKSSA-N |
| XLogP | 3.66 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|