C25H22N4O4S2 — CID 1275634
N-[4-[[4-[(4-methylsulfanylphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]sulfamoyl]phenyl]acetamide (PubChem CID 1275634) has the molecular formula C25H22N4O4S2 and a molecular weight of 506.61 g/mol. Its IUPAC name is N-[4-[[4-[(4-methylsulfanylphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-[(4-methylsulfanylphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 1275634 |
| Molecular Formula | C25H22N4O4S2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | N-[4-[[4-[(4-methylsulfanylphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CSc1ccc(C=C2N=C(c3ccccc3)N(NS(=O)(=O)c3ccc(NC(C)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H22N4O4S2/c1-17(30)26-20-10-14-22(15-11-20)35(32,33)28-29-24(19-6-4-3-5-7-19)27-23(25(29)31)16-18-8-12-21(34-2)13-9-18/h3-16,28H,1-2H3,(H,26,30) |
| InChIKey | WUXOVBLXJZVMDQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|