C27H20N2O7S3 — CID 6525376
2-[(4Z)-4-[(4-methylsulfanylphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]naphthalene-1,5-disulfonic acid (PubChem CID 6525376) has the molecular formula C27H20N2O7S3 and a molecular weight of 580.67 g/mol. Its IUPAC name is 2-[(4Z)-4-[(4-methylsulfanylphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]naphthalene-1,5-disulfonic acid.
| Compound Name | 2-[(4Z)-4-[(4-methylsulfanylphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 6525376 |
| Molecular Formula | C27H20N2O7S3 |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | 2-[(4Z)-4-[(4-methylsulfanylphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]naphthalene-1,5-disulfonic acid |
| SMILES | CSc1ccc(/C=C2\N=C(c3ccccc3)N(c3ccc4c(S(=O)(=O)O)cccc4c3S(=O)(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C27H20N2O7S3/c1-37-19-12-10-17(11-13-19)16-22-27(30)29(26(28-22)18-6-3-2-4-7-18)23-15-14-20-21(25(23)39(34,35)36)8-5-9-24(20)38(31,32)33/h2-16H,1H3,(H,31,32,33)(H,34,35,36)/b22-16- |
| InChIKey | QMRSZVKOWGYAQU-JWGURIENSA-N |
| XLogP | 4.89 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|