C28H20N2O7S2 — CID 3681661
2-(4-cinnamylidene-5-oxo-2-phenylimidazol-1-yl)naphthalene-1,5-disulfonic acid (PubChem CID 3681661) has the molecular formula C28H20N2O7S2 and a molecular weight of 560.61 g/mol. Its IUPAC name is 2-(4-cinnamylidene-5-oxo-2-phenylimidazol-1-yl)naphthalene-1,5-disulfonic acid.
| Compound Name | 2-(4-cinnamylidene-5-oxo-2-phenylimidazol-1-yl)naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 3681661 |
| Molecular Formula | C28H20N2O7S2 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | 2-(4-cinnamylidene-5-oxo-2-phenylimidazol-1-yl)naphthalene-1,5-disulfonic acid |
| SMILES | O=C1C(=CC=Cc2ccccc2)N=C(c2ccccc2)N1c1ccc2c(S(=O)(=O)O)cccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C28H20N2O7S2/c31-28-23(15-7-11-19-9-3-1-4-10-19)29-27(20-12-5-2-6-13-20)30(28)24-18-17-21-22(26(24)39(35,36)37)14-8-16-25(21)38(32,33)34/h1-18H,(H,32,33,34)(H,35,36,37) |
| InChIKey | HDZIUJZOLAMDAF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|