C26H18N2O7S2 — CID 3763997
2-(4-benzylidene-5-oxo-2-phenylimidazol-1-yl)naphthalene-1,5-disulfonic acid (PubChem CID 3763997) has the molecular formula C26H18N2O7S2 and a molecular weight of 534.57 g/mol. Its IUPAC name is 2-(4-benzylidene-5-oxo-2-phenylimidazol-1-yl)naphthalene-1,5-disulfonic acid.
| Compound Name | 2-(4-benzylidene-5-oxo-2-phenylimidazol-1-yl)naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 3763997 |
| Molecular Formula | C26H18N2O7S2 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 2-(4-benzylidene-5-oxo-2-phenylimidazol-1-yl)naphthalene-1,5-disulfonic acid |
| SMILES | O=C1C(=Cc2ccccc2)N=C(c2ccccc2)N1c1ccc2c(S(=O)(=O)O)cccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C26H18N2O7S2/c29-26-21(16-17-8-3-1-4-9-17)27-25(18-10-5-2-6-11-18)28(26)22-15-14-19-20(24(22)37(33,34)35)12-7-13-23(19)36(30,31)32/h1-16H,(H,30,31,32)(H,33,34,35) |
| InChIKey | CQRQOGBLSPQNOA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|