C19H13N3OS — CID 682030
(5E)-5-benzylidene-2-phenyl-3-(1,3-thiazol-2-yl)imidazol-4-one (PubChem CID 682030) has the molecular formula C19H13N3OS and a molecular weight of 331.40 g/mol. Its IUPAC name is (5E)-5-benzylidene-2-phenyl-3-(1,3-thiazol-2-yl)imidazol-4-one.
| Compound Name | (5E)-5-benzylidene-2-phenyl-3-(1,3-thiazol-2-yl)imidazol-4-one |
|---|---|
| PubChem CID | 682030 |
| Molecular Formula | C19H13N3OS |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (5E)-5-benzylidene-2-phenyl-3-(1,3-thiazol-2-yl)imidazol-4-one |
| SMILES | O=C1/C(=C\c2ccccc2)N=C(c2ccccc2)N1c1nccs1 |
| InChI | InChI=1S/C19H13N3OS/c23-18-16(13-14-7-3-1-4-8-14)21-17(15-9-5-2-6-10-15)22(18)19-20-11-12-24-19/h1-13H/b16-13+ |
| InChIKey | CYOJFEJQJWQSOS-DTQAZKPQSA-N |
| XLogP | 3.98 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|