C24H19N5OS — CID 5026373
5-[[4-(dimethylamino)phenyl]methylidene]-2-phenyl-3-([1,3]thiazolo[4,5-b]pyridin-2-yl)imidazol-4-one (PubChem CID 5026373) has the molecular formula C24H19N5OS and a molecular weight of 425.52 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)phenyl]methylidene]-2-phenyl-3-([1,3]thiazolo[4,5-b]pyridin-2-yl)imidazol-4-one.
| Compound Name | 5-[[4-(dimethylamino)phenyl]methylidene]-2-phenyl-3-([1,3]thiazolo[4,5-b]pyridin-2-yl)imidazol-4-one |
|---|---|
| PubChem CID | 5026373 |
| Molecular Formula | C24H19N5OS |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 5-[[4-(dimethylamino)phenyl]methylidene]-2-phenyl-3-([1,3]thiazolo[4,5-b]pyridin-2-yl)imidazol-4-one |
| SMILES | CN(C)c1ccc(C=C2N=C(c3ccccc3)N(c3nc4ncccc4s3)C2=O)cc1 |
| InChI | InChI=1S/C24H19N5OS/c1-28(2)18-12-10-16(11-13-18)15-19-23(30)29(22(26-19)17-7-4-3-5-8-17)24-27-21-20(31-24)9-6-14-25-21/h3-15H,1-2H3 |
| InChIKey | ZFDPENMTIAXREC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|