C30H25ClN6O — CID 10436722
(5E)-5-[(4-chlorophenyl)methylidene]-3-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-6-methyl-1,2,4-triazin-3-yl]-2-phenylimidazol-4-one (PubChem CID 10436722) has the molecular formula C30H25ClN6O and a molecular weight of 521.02 g/mol. Its IUPAC name is (5E)-5-[(4-chlorophenyl)methylidene]-3-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-6-methyl-1,2,4-triazin-3-yl]-2-phenylimidazol-4-one.
| Compound Name | (5E)-5-[(4-chlorophenyl)methylidene]-3-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-6-methyl-1,2,4-triazin-3-yl]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 10436722 |
| Molecular Formula | C30H25ClN6O |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | (5E)-5-[(4-chlorophenyl)methylidene]-3-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-6-methyl-1,2,4-triazin-3-yl]-2-phenylimidazol-4-one |
| SMILES | Cc1nnc(N2C(=O)/C(=C\c3ccc(Cl)cc3)N=C2c2ccccc2)nc1/C=C/c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C30H25ClN6O/c1-20-26(18-13-21-11-16-25(17-12-21)36(2)3)33-30(35-34-20)37-28(23-7-5-4-6-8-23)32-27(29(37)38)19-22-9-14-24(31)15-10-22/h4-19H,1-3H3/b18-13+,27-19+ |
| InChIKey | PRXJMHYXKARHIA-VSEUVJPWSA-N |
| XLogP | 5.90 |
| TPSA | 74.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|