C19H13ClN4OS — CID 11188186
(5E)-5-[(4-chlorophenyl)methylidene]-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenylimidazol-4-one (PubChem CID 11188186) has the molecular formula C19H13ClN4OS and a molecular weight of 380.86 g/mol. Its IUPAC name is (5E)-5-[(4-chlorophenyl)methylidene]-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenylimidazol-4-one.
| Compound Name | (5E)-5-[(4-chlorophenyl)methylidene]-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 11188186 |
| Molecular Formula | C19H13ClN4OS |
| Molecular Weight | 380.86 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (5E)-5-[(4-chlorophenyl)methylidene]-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenylimidazol-4-one |
| SMILES | Cc1nnc(N2C(=O)/C(=C\c3ccc(Cl)cc3)N=C2c2ccccc2)s1 |
| InChI | InChI=1S/C19H13ClN4OS/c1-12-22-23-19(26-12)24-17(14-5-3-2-4-6-14)21-16(18(24)25)11-13-7-9-15(20)10-8-13/h2-11H,1H3/b16-11+ |
| InChIKey | USAGYFZNJLUBEI-LFIBNONCSA-N |
| XLogP | 4.33 |
| TPSA | 58.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.86 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|