C35H27N11OS2 — CID 6516609
(5E)-3-[[4,6-bis(1,3-benzothiazol-2-ylamino)-1,3,5-triazin-2-yl]amino]-5-[[4-(dimethylamino)phenyl]methylidene]-2-phenylimidazol-4-one (PubChem CID 6516609) has the molecular formula C35H27N11OS2 and a molecular weight of 681.81 g/mol. Its IUPAC name is (5E)-3-[[4,6-bis(1,3-benzothiazol-2-ylamino)-1,3,5-triazin-2-yl]amino]-5-[[4-(dimethylamino)phenyl]methylidene]-2-phenylimidazol-4-one.
| Compound Name | (5E)-3-[[4,6-bis(1,3-benzothiazol-2-ylamino)-1,3,5-triazin-2-yl]amino]-5-[[4-(dimethylamino)phenyl]methylidene]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 6516609 |
| Molecular Formula | C35H27N11OS2 |
| Molecular Weight | 681.81 g/mol |
| Exact Mass | 681.18 |
| IUPAC Name | (5E)-3-[[4,6-bis(1,3-benzothiazol-2-ylamino)-1,3,5-triazin-2-yl]amino]-5-[[4-(dimethylamino)phenyl]methylidene]-2-phenylimidazol-4-one |
| SMILES | CN(C)c1ccc(/C=C2/N=C(c3ccccc3)N(Nc3nc(Nc4nc5ccccc5s4)nc(Nc4nc5ccccc5s4)n3)C2=O)cc1 |
| InChI | InChI=1S/C35H27N11OS2/c1-45(2)23-18-16-21(17-19-23)20-26-30(47)46(29(36-26)22-10-4-3-5-11-22)44-33-40-31(42-34-37-24-12-6-8-14-27(24)48-34)39-32(41-33)43-35-38-25-13-7-9-15-28(25)49-35/h3-20H,1-2H3,(H3,37,38,39,40,41,42,43,44)/b26-20+ |
| InChIKey | MRAUPFJCCQODCU-LHLOQNFPSA-N |
| XLogP | 7.30 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.81 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|