C26H24N6O4 — CID 10624717
2-[[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]amino]-N-(4-nitrophenyl)acetamide (PubChem CID 10624717) has the molecular formula C26H24N6O4 and a molecular weight of 484.52 g/mol. Its IUPAC name is 2-[[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]amino]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]amino]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 10624717 |
| Molecular Formula | C26H24N6O4 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 2-[[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]amino]-N-(4-nitrophenyl)acetamide |
| SMILES | CN(C)c1ccc(/C=C2\N=C(c3ccccc3)N(NCC(=O)Nc3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H24N6O4/c1-30(2)21-12-8-18(9-13-21)16-23-26(34)31(25(29-23)19-6-4-3-5-7-19)27-17-24(33)28-20-10-14-22(15-11-20)32(35)36/h3-16,27H,17H2,1-2H3,(H,28,33)/b23-16- |
| InChIKey | UVICCJNAABMBDE-KQWNVCNZSA-N |
| XLogP | 3.43 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|