C33H24N8O6 — CID 5471430
(5Z)-5-[(3-nitrophenyl)methylidene]-3-[[[(4Z)-4-[(3-nitrophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]amino]methylamino]-2-phenylimidazol-4-one (PubChem CID 5471430) has the molecular formula C33H24N8O6 and a molecular weight of 628.61 g/mol. Its IUPAC name is (5Z)-5-[(3-nitrophenyl)methylidene]-3-[[[(4Z)-4-[(3-nitrophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]amino]methylamino]-2-phenylimidazol-4-one.
| Compound Name | (5Z)-5-[(3-nitrophenyl)methylidene]-3-[[[(4Z)-4-[(3-nitrophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]amino]methylamino]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 5471430 |
| Molecular Formula | C33H24N8O6 |
| Molecular Weight | 628.61 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | (5Z)-5-[(3-nitrophenyl)methylidene]-3-[[[(4Z)-4-[(3-nitrophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]amino]methylamino]-2-phenylimidazol-4-one |
| SMILES | O=C1/C(=C/c2cccc([N+](=O)[O-])c2)N=C(c2ccccc2)N1NCNN1C(=O)/C(=C/c2cccc([N+](=O)[O-])c2)N=C1c1ccccc1 |
| InChI | InChI=1S/C33H24N8O6/c42-32-28(19-22-9-7-15-26(17-22)40(44)45)36-30(24-11-3-1-4-12-24)38(32)34-21-35-39-31(25-13-5-2-6-14-25)37-29(33(39)43)20-23-10-8-16-27(18-23)41(46)47/h1-20,34-35H,21H2/b28-19-,29-20- |
| InChIKey | DSZYAFJAKVDNCO-HNXTVNFMSA-N |
| XLogP | 4.43 |
| TPSA | 175.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|