C35H26N6O7S — CID 11621686
2-[3-(4-methoxyphenyl)-2',4-dioxospiro[1,3-thiazolidine-2,3'-indole]-1'-yl]-N-[(4Z)-4-[(3-nitrophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]acetamide (PubChem CID 11621686) has the molecular formula C35H26N6O7S and a molecular weight of 674.70 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-2',4-dioxospiro[1,3-thiazolidine-2,3'-indole]-1'-yl]-N-[(4Z)-4-[(3-nitrophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]acetamide.
| Compound Name | 2-[3-(4-methoxyphenyl)-2',4-dioxospiro[1,3-thiazolidine-2,3'-indole]-1'-yl]-N-[(4Z)-4-[(3-nitrophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 11621686 |
| Molecular Formula | C35H26N6O7S |
| Molecular Weight | 674.70 g/mol |
| Exact Mass | 674.16 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-2',4-dioxospiro[1,3-thiazolidine-2,3'-indole]-1'-yl]-N-[(4Z)-4-[(3-nitrophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]acetamide |
| SMILES | COc1ccc(N2C(=O)CSC23C(=O)N(CC(=O)NN2C(=O)/C(=C/c4cccc([N+](=O)[O-])c4)N=C2c2ccccc2)c2ccccc23)cc1 |
| InChI | InChI=1S/C35H26N6O7S/c1-48-26-16-14-24(15-17-26)39-31(43)21-49-35(39)27-12-5-6-13-29(27)38(34(35)45)20-30(42)37-40-32(23-9-3-2-4-10-23)36-28(33(40)44)19-22-8-7-11-25(18-22)41(46)47/h2-19H,20-21H2,1H3,(H,37,42)/b28-19- |
| InChIKey | DSJFWXLPLJVHRC-USHMODERSA-N |
| XLogP | 4.24 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|