C32H24N10O8 — CID 11980224
3-[[4,6-bis(2-hydroxy-4-nitroanilino)-1,3,5-triazin-2-yl]amino]-5-[(4-methoxyphenyl)methylidene]-2-phenylimidazol-4-one (PubChem CID 11980224) has the molecular formula C32H24N10O8 and a molecular weight of 676.61 g/mol. Its IUPAC name is 3-[[4,6-bis(2-hydroxy-4-nitroanilino)-1,3,5-triazin-2-yl]amino]-5-[(4-methoxyphenyl)methylidene]-2-phenylimidazol-4-one.
| Compound Name | 3-[[4,6-bis(2-hydroxy-4-nitroanilino)-1,3,5-triazin-2-yl]amino]-5-[(4-methoxyphenyl)methylidene]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 11980224 |
| Molecular Formula | C32H24N10O8 |
| Molecular Weight | 676.61 g/mol |
| Exact Mass | 676.18 |
| IUPAC Name | 3-[[4,6-bis(2-hydroxy-4-nitroanilino)-1,3,5-triazin-2-yl]amino]-5-[(4-methoxyphenyl)methylidene]-2-phenylimidazol-4-one |
| SMILES | COc1ccc(C=C2N=C(c3ccccc3)N(Nc3nc(Nc4ccc([N+](=O)[O-])cc4O)nc(Nc4ccc([N+](=O)[O-])cc4O)n3)C2=O)cc1 |
| InChI | InChI=1S/C32H24N10O8/c1-50-22-11-7-18(8-12-22)15-25-29(45)40(28(33-25)19-5-3-2-4-6-19)39-32-37-30(34-23-13-9-20(41(46)47)16-26(23)43)36-31(38-32)35-24-14-10-21(42(48)49)17-27(24)44/h2-17,43-44H,1H3,(H3,34,35,36,37,38,39) |
| InChIKey | IZNDHLHPVNFMFI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 243.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|