C23H17N3O4S — CID 3672275
3-(2-hydroxy-4-nitrophenyl)-5-[(4-methylsulfanylphenyl)methylidene]-2-phenylimidazol-4-one (PubChem CID 3672275) has the molecular formula C23H17N3O4S and a molecular weight of 431.47 g/mol. Its IUPAC name is 3-(2-hydroxy-4-nitrophenyl)-5-[(4-methylsulfanylphenyl)methylidene]-2-phenylimidazol-4-one.
| Compound Name | 3-(2-hydroxy-4-nitrophenyl)-5-[(4-methylsulfanylphenyl)methylidene]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 3672275 |
| Molecular Formula | C23H17N3O4S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 3-(2-hydroxy-4-nitrophenyl)-5-[(4-methylsulfanylphenyl)methylidene]-2-phenylimidazol-4-one |
| SMILES | CSc1ccc(C=C2N=C(c3ccccc3)N(c3ccc([N+](=O)[O-])cc3O)C2=O)cc1 |
| InChI | InChI=1S/C23H17N3O4S/c1-31-18-10-7-15(8-11-18)13-19-23(28)25(22(24-19)16-5-3-2-4-6-16)20-12-9-17(26(29)30)14-21(20)27/h2-14,27H,1H3 |
| InChIKey | SGMAOAGVCHWDKL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|