C22H14N4O6 — CID 26476141
(5E)-3-(2-hydroxy-4-nitrophenyl)-5-[(2-nitrophenyl)methylidene]-2-phenylimidazol-4-one (PubChem CID 26476141) has the molecular formula C22H14N4O6 and a molecular weight of 430.38 g/mol. Its IUPAC name is (5E)-3-(2-hydroxy-4-nitrophenyl)-5-[(2-nitrophenyl)methylidene]-2-phenylimidazol-4-one.
| Compound Name | (5E)-3-(2-hydroxy-4-nitrophenyl)-5-[(2-nitrophenyl)methylidene]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 26476141 |
| Molecular Formula | C22H14N4O6 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | (5E)-3-(2-hydroxy-4-nitrophenyl)-5-[(2-nitrophenyl)methylidene]-2-phenylimidazol-4-one |
| SMILES | O=C1/C(=C\c2ccccc2[N+](=O)[O-])N=C(c2ccccc2)N1c1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C22H14N4O6/c27-20-13-16(25(29)30)10-11-19(20)24-21(14-6-2-1-3-7-14)23-17(22(24)28)12-15-8-4-5-9-18(15)26(31)32/h1-13,27H/b17-12+ |
| InChIKey | PNMCUIYFTXKUEA-SFQUDFHCSA-N |
| XLogP | 4.04 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|