C27H25N5O4 — CID 135822044
3-[(E)-[5-(diethylamino)-2-hydroxyphenyl]methylideneamino]-5-[(2-nitrophenyl)methylidene]-2-phenylimidazol-4-one (PubChem CID 135822044) has the molecular formula C27H25N5O4 and a molecular weight of 483.53 g/mol. Its IUPAC name is 3-[(E)-[5-(diethylamino)-2-hydroxyphenyl]methylideneamino]-5-[(2-nitrophenyl)methylidene]-2-phenylimidazol-4-one.
| Compound Name | 3-[(E)-[5-(diethylamino)-2-hydroxyphenyl]methylideneamino]-5-[(2-nitrophenyl)methylidene]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 135822044 |
| Molecular Formula | C27H25N5O4 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 3-[(E)-[5-(diethylamino)-2-hydroxyphenyl]methylideneamino]-5-[(2-nitrophenyl)methylidene]-2-phenylimidazol-4-one |
| SMILES | CCN(CC)c1ccc(O)c(/C=N/N2C(=O)C(=Cc3ccccc3[N+](=O)[O-])N=C2c2ccccc2)c1 |
| InChI | InChI=1S/C27H25N5O4/c1-3-30(4-2)22-14-15-25(33)21(16-22)18-28-31-26(19-10-6-5-7-11-19)29-23(27(31)34)17-20-12-8-9-13-24(20)32(35)36/h5-18,33H,3-4H2,1-2H3/b23-17?,28-18+ |
| InChIKey | MQZHIYZKCMYJQI-DEPDUTSLSA-N |
| XLogP | 4.81 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|