C31H24N10O8 — CID 75539363
(5E)-3-[[4,6-bis(4-methoxy-2-nitroanilino)-1,3,5-triazin-2-yl]amino]-5-(furan-2-ylmethylidene)-2-phenylimidazol-4-one (PubChem CID 75539363) has the molecular formula C31H24N10O8 and a molecular weight of 664.60 g/mol. Its IUPAC name is (5E)-3-[[4,6-bis(4-methoxy-2-nitroanilino)-1,3,5-triazin-2-yl]amino]-5-(furan-2-ylmethylidene)-2-phenylimidazol-4-one.
| Compound Name | (5E)-3-[[4,6-bis(4-methoxy-2-nitroanilino)-1,3,5-triazin-2-yl]amino]-5-(furan-2-ylmethylidene)-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 75539363 |
| Molecular Formula | C31H24N10O8 |
| Molecular Weight | 664.60 g/mol |
| Exact Mass | 664.18 |
| IUPAC Name | (5E)-3-[[4,6-bis(4-methoxy-2-nitroanilino)-1,3,5-triazin-2-yl]amino]-5-(furan-2-ylmethylidene)-2-phenylimidazol-4-one |
| SMILES | COc1ccc(Nc2nc(Nc3ccc(OC)cc3[N+](=O)[O-])nc(NN3C(=O)/C(=C\c4ccco4)N=C3c3ccccc3)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H24N10O8/c1-47-19-10-12-22(25(16-19)40(43)44)33-29-35-30(34-23-13-11-20(48-2)17-26(23)41(45)46)37-31(36-29)38-39-27(18-7-4-3-5-8-18)32-24(28(39)42)15-21-9-6-14-49-21/h3-17H,1-2H3,(H3,33,34,35,36,37,38)/b24-15+ |
| InChIKey | GFZIGTRAZODIDS-BUVRLJJBSA-N |
| XLogP | 5.44 |
| TPSA | 225.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|