C23H17N3O6S — CID 6979120
(E)-3-[4-[[(4E)-4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 6979120) has the molecular formula C23H17N3O6S and a molecular weight of 463.47 g/mol. Its IUPAC name is (E)-3-[4-[[(4E)-4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[(4E)-4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6979120 |
| Molecular Formula | C23H17N3O6S |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | (E)-3-[4-[[(4E)-4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(S(=O)(=O)NN2C(=O)/C(=C\c3ccco3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17N3O6S/c27-21(28)13-10-16-8-11-19(12-9-16)33(30,31)25-26-22(17-5-2-1-3-6-17)24-20(23(26)29)15-18-7-4-14-32-18/h1-15,25H,(H,27,28)/b13-10+,20-15+ |
| InChIKey | ZPCKYZVGSXXRDJ-JEDUTTKESA-N |
| XLogP | 2.90 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|