C22H14N4O3 — CID 135748227
(3Z)-3-[(4E)-4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]imino-1H-indol-2-one (PubChem CID 135748227) has the molecular formula C22H14N4O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is (3Z)-3-[(4E)-4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]imino-1H-indol-2-one.
| Compound Name | (3Z)-3-[(4E)-4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]imino-1H-indol-2-one |
|---|---|
| PubChem CID | 135748227 |
| Molecular Formula | C22H14N4O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (3Z)-3-[(4E)-4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]imino-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=N/N1C(=O)/C(=C\c2ccco2)N=C1c1ccccc1 |
| InChI | InChI=1S/C22H14N4O3/c27-21-19(16-10-4-5-11-17(16)24-21)25-26-20(14-7-2-1-3-8-14)23-18(22(26)28)13-15-9-6-12-29-15/h1-13H,(H,24,25,27)/b18-13+ |
| InChIKey | IXVTZZWMRHBMPI-QGOAFFKASA-N |
| XLogP | 3.27 |
| TPSA | 87.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|