C11H8N4O3 — CID 135956380
3-[(Z)-(2-oxo-1H-indol-3-ylidene)amino]imidazolidine-2,4-dione (PubChem CID 135956380) has the molecular formula C11H8N4O3 and a molecular weight of 244.21 g/mol. Its IUPAC name is 3-[(Z)-(2-oxo-1H-indol-3-ylidene)amino]imidazolidine-2,4-dione.
| Compound Name | 3-[(Z)-(2-oxo-1H-indol-3-ylidene)amino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 135956380 |
| Molecular Formula | C11H8N4O3 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 3-[(Z)-(2-oxo-1H-indol-3-ylidene)amino]imidazolidine-2,4-dione |
| SMILES | O=C1Nc2ccccc2/C1=N/N1C(=O)CNC1=O |
| InChI | InChI=1S/C11H8N4O3/c16-8-5-12-11(18)15(8)14-9-6-3-1-2-4-7(6)13-10(9)17/h1-4H,5H2,(H,12,18)(H,13,14,17) |
| InChIKey | SEXYXDVARGLOGK-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|