C22H20N4O2 — CID 139084077
3-[(1R,2R)-2-[(2-oxo-1H-indol-3-ylidene)amino]cyclohexyl]imino-1H-indol-2-one (PubChem CID 139084077) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 3-[(1R,2R)-2-[(2-oxo-1H-indol-3-ylidene)amino]cyclohexyl]imino-1H-indol-2-one.
| Compound Name | 3-[(1R,2R)-2-[(2-oxo-1H-indol-3-ylidene)amino]cyclohexyl]imino-1H-indol-2-one |
|---|---|
| PubChem CID | 139084077 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-[(1R,2R)-2-[(2-oxo-1H-indol-3-ylidene)amino]cyclohexyl]imino-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=N/[C@@H]1CCCC[C@H]1/N=C1\C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C22H20N4O2/c27-21-19(13-7-1-3-9-15(13)25-21)23-17-11-5-6-12-18(17)24-20-14-8-2-4-10-16(14)26-22(20)28/h1-4,7-10,17-18H,5-6,11-12H2,(H,23,25,27)(H,24,26,28)/t17-,18-/m1/s1 |
| InChIKey | MXROUNWGQSTBQY-QZTJIDSGSA-N |
| XLogP | 3.18 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|