C16H9N3O3 — CID 135484693
2-[(2-oxo-1H-indol-3-ylidene)amino]isoindole-1,3-dione (PubChem CID 135484693) has the molecular formula C16H9N3O3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-[(2-oxo-1H-indol-3-ylidene)amino]isoindole-1,3-dione.
| Compound Name | 2-[(2-oxo-1H-indol-3-ylidene)amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135484693 |
| Molecular Formula | C16H9N3O3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-[(2-oxo-1H-indol-3-ylidene)amino]isoindole-1,3-dione |
| SMILES | O=C1Nc2ccccc2C1=NN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H9N3O3/c20-14-13(11-7-3-4-8-12(11)17-14)18-19-15(21)9-5-1-2-6-10(9)16(19)22/h1-8H,(H,17,18,20) |
| InChIKey | PKBGCTPSZGZZRK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|