C16H5Cl4N3O3 — CID 135908700
4,5,6,7-tetrachloro-2-[(E)-(2-oxo-1H-indol-3-ylidene)amino]isoindole-1,3-dione (PubChem CID 135908700) has the molecular formula C16H5Cl4N3O3 and a molecular weight of 429.05 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[(E)-(2-oxo-1H-indol-3-ylidene)amino]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[(E)-(2-oxo-1H-indol-3-ylidene)amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135908700 |
| Molecular Formula | C16H5Cl4N3O3 |
| Molecular Weight | 429.05 g/mol |
| Exact Mass | 426.91 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[(E)-(2-oxo-1H-indol-3-ylidene)amino]isoindole-1,3-dione |
| SMILES | O=C1Nc2ccccc2/C1=N\N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C16H5Cl4N3O3/c17-9-7-8(10(18)12(20)11(9)19)16(26)23(15(7)25)22-13-5-3-1-2-4-6(5)21-14(13)24/h1-4H,(H,21,22,24) |
| InChIKey | HFVGNPNWJAPQFJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.05 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|